About 1-fluorobutan-1-ol;tetramethylazanium
1-fluorobutan-1-ol;tetramethylazanium (PubChem CID 175292318) has the molecular formula C8H21FNO+
and a molecular weight of 166.26 g/mol. Its IUPAC name is 1-fluorobutan-1-ol;tetramethylazanium.
Molecular Properties
| Compound Name | 1-fluorobutan-1-ol;tetramethylazanium |
| PubChem CID | 175292318 |
| Molecular Formula | C8H21FNO+ |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | 1-fluorobutan-1-ol;tetramethylazanium |
| SMILES | CCCC(O)F.C[N+](C)(C)C |
| InChI | InChI=1S/C4H9FO.C4H12N/c1-2-3-4(5)6;1-5(2,3)4/h4,6H,2-3H2,1H3;1-4H3/q;+1 |
| InChIKey | APWCGQWTTJKUDP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorobutan-1-ol;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobutan-1-ol;tetramethylazanium?
The IUPAC name of 1-fluorobutan-1-ol;tetramethylazanium (CID 175292318) is 1-fluorobutan-1-ol;tetramethylazanium.
What is the SMILES notation for 1-fluorobutan-1-ol;tetramethylazanium?
The canonical SMILES for 1-fluorobutan-1-ol;tetramethylazanium is CCCC(O)F.C[N+](C)(C)C.
What is the InChIKey of 1-fluorobutan-1-ol;tetramethylazanium?
The InChIKey is APWCGQWTTJKUDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FO.C4H12N/c1-2-3-4(5)6;1-5(2,3)4/h4,6H,2-3H2,1H3;1-4H3/q;+1.
What are the key properties of 1-fluorobutan-1-ol;tetramethylazanium?
1-fluorobutan-1-ol;tetramethylazanium has a molecular weight of 166.26 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobutan-1-ol;tetramethylazanium is sourced from PubChem (CID 175292318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).