C3H7FO2 — CID 91101835
1-fluoropropane-1,3-diol (PubChem CID 91101835) has the molecular formula C3H7FO2 and a molecular weight of 94.09 g/mol. Its IUPAC name is 1-fluoropropane-1,3-diol.
| Compound Name | 1-fluoropropane-1,3-diol |
|---|---|
| PubChem CID | 91101835 |
| Molecular Formula | C3H7FO2 |
| Molecular Weight | 94.09 g/mol |
| Exact Mass | 94.04 |
| IUPAC Name | 1-fluoropropane-1,3-diol |
| SMILES | OCCC(O)F |
| InChI | InChI=1S/C3H7FO2/c4-3(6)1-2-5/h3,5-6H,1-2H2 |
| InChIKey | WIARMKVBSWKALG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.09 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |