About carbanide;1,2-difluoroethanol;rutherfordium
carbanide;1,2-difluoroethanol;rutherfordium (PubChem CID 58942634) has the molecular formula C3H7F2ORf-
and a molecular weight of 364.08 g/mol. Its IUPAC name is carbanide;1,2-difluoroethanol;rutherfordium.
Molecular Properties
| Compound Name | carbanide;1,2-difluoroethanol;rutherfordium |
| PubChem CID | 58942634 |
| Molecular Formula | C3H7F2ORf- |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | carbanide;1,2-difluoroethanol;rutherfordium |
| SMILES | OC(F)CF.[CH3-].[Rf] |
| InChI | InChI=1S/C2H4F2O.CH3.Rf/c3-1-2(4)5;;/h2,5H,1H2;1H3;/q;-1; |
| InChIKey | KUHFEASYSKVNKM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1,2-difluoroethanol;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1,2-difluoroethanol;rutherfordium?
The IUPAC name of carbanide;1,2-difluoroethanol;rutherfordium (CID 58942634) is carbanide;1,2-difluoroethanol;rutherfordium.
What is the SMILES notation for carbanide;1,2-difluoroethanol;rutherfordium?
The canonical SMILES for carbanide;1,2-difluoroethanol;rutherfordium is OC(F)CF.[CH3-].[Rf].
What is the InChIKey of carbanide;1,2-difluoroethanol;rutherfordium?
The InChIKey is KUHFEASYSKVNKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4F2O.CH3.Rf/c3-1-2(4)5;;/h2,5H,1H2;1H3;/q;-1;.
What are the key properties of carbanide;1,2-difluoroethanol;rutherfordium?
carbanide;1,2-difluoroethanol;rutherfordium has a molecular weight of 364.08 g/mol, XLogP of 0.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1,2-difluoroethanol;rutherfordium is sourced from PubChem (CID 58942634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).