C5H9F3O — CID 142508491
1,4,4-trifluoro-3-methylbutan-1-ol (PubChem CID 142508491) has the molecular formula C5H9F3O and a molecular weight of 142.12 g/mol. Its IUPAC name is 1,4,4-trifluoro-3-methylbutan-1-ol.
| Compound Name | 1,4,4-trifluoro-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 142508491 |
| Molecular Formula | C5H9F3O |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 1,4,4-trifluoro-3-methylbutan-1-ol |
| SMILES | CC(CC(O)F)C(F)F |
| InChI | InChI=1S/C5H9F3O/c1-3(5(7)8)2-4(6)9/h3-5,9H,2H2,1H3 |
| InChIKey | DVCJCBTXYZPMCB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |