C6H11F3O2 — CID 87694128
1,1,5-trifluoro-3-methylpentane-2,4-diol (PubChem CID 87694128) has the molecular formula C6H11F3O2 and a molecular weight of 172.15 g/mol. Its IUPAC name is 1,1,5-trifluoro-3-methylpentane-2,4-diol.
| Compound Name | 1,1,5-trifluoro-3-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 87694128 |
| Molecular Formula | C6H11F3O2 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1,1,5-trifluoro-3-methylpentane-2,4-diol |
| SMILES | CC(C(O)CF)C(O)C(F)F |
| InChI | InChI=1S/C6H11F3O2/c1-3(4(10)2-7)5(11)6(8)9/h3-6,10-11H,2H2,1H3 |
| InChIKey | HAHKHIJUOYAZJO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |