C7H15FO2 — CID 134933849
(2S,3R)-2-fluoro-5-methylhexane-1,3-diol (PubChem CID 134933849) has the molecular formula C7H15FO2 and a molecular weight of 150.19 g/mol. Its IUPAC name is (2S,3R)-2-fluoro-5-methylhexane-1,3-diol.
| Compound Name | (2S,3R)-2-fluoro-5-methylhexane-1,3-diol |
|---|---|
| PubChem CID | 134933849 |
| Molecular Formula | C7H15FO2 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.11 |
| IUPAC Name | (2S,3R)-2-fluoro-5-methylhexane-1,3-diol |
| SMILES | CC(C)C[C@@H](O)[C@@H](F)CO |
| InChI | InChI=1S/C7H15FO2/c1-5(2)3-7(10)6(8)4-9/h5-7,9-10H,3-4H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | JNHLMUYFJUJQDR-NKWVEPMBSA-N |
| XLogP | 0.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |