C8H19NO2 — CID 166674176
(2S)-1-(dimethylamino)-4-methylpentane-1,2-diol (PubChem CID 166674176) has the molecular formula C8H19NO2 and a molecular weight of 161.24 g/mol. Its IUPAC name is (2S)-1-(dimethylamino)-4-methylpentane-1,2-diol.
| Compound Name | (2S)-1-(dimethylamino)-4-methylpentane-1,2-diol |
|---|---|
| PubChem CID | 166674176 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | (2S)-1-(dimethylamino)-4-methylpentane-1,2-diol |
| SMILES | CC(C)C[C@H](O)C(O)N(C)C |
| InChI | InChI=1S/C8H19NO2/c1-6(2)5-7(10)8(11)9(3)4/h6-8,10-11H,5H2,1-4H3/t7-,8?/m0/s1 |
| InChIKey | XKJDBJLYQSCION-JAMMHHFISA-N |
| XLogP | 0.27 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|