C6H12F2O — CID 171795425
(2R)-1,1-difluoro-4-methylpentan-2-ol (PubChem CID 171795425) has the molecular formula C6H12F2O and a molecular weight of 138.16 g/mol. Its IUPAC name is (2R)-1,1-difluoro-4-methylpentan-2-ol.
| Compound Name | (2R)-1,1-difluoro-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 171795425 |
| Molecular Formula | C6H12F2O |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | (2R)-1,1-difluoro-4-methylpentan-2-ol |
| SMILES | CC(C)C[C@@H](O)C(F)F |
| InChI | InChI=1S/C6H12F2O/c1-4(2)3-5(9)6(7)8/h4-6,9H,3H2,1-2H3/t5-/m1/s1 |
| InChIKey | AZVRGGWROSJXNR-RXMQYKEDSA-N |
| XLogP | 1.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |