C21H48O15 — CID 157441175
4-methylhexane-1,2,3,5,6-pentol (PubChem CID 157441175) has the molecular formula C21H48O15 and a molecular weight of 540.60 g/mol. Its IUPAC name is 4-methylhexane-1,2,3,5,6-pentol.
| Compound Name | 4-methylhexane-1,2,3,5,6-pentol |
|---|---|
| PubChem CID | 157441175 |
| Molecular Formula | C21H48O15 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 4-methylhexane-1,2,3,5,6-pentol |
| SMILES | CC(C(O)CO)C(O)C(O)CO.CC(C(O)CO)C(O)C(O)CO.CC(C(O)CO)C(O)C(O)CO |
| InChI | InChI=1S/3C7H16O5/c3*1-4(5(10)2-8)7(12)6(11)3-9/h3*4-12H,2-3H2,1H3 |
| InChIKey | BRRPYLYXXNHUFG-UHFFFAOYSA-N |
| XLogP | -6.93 |
| TPSA | 303.45 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | -6.93 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 15 |