C31H68O12 — CID 159414680
(2R,3R,4R,5S)-7,7-dimethyloctane-1,2,3,4,5-pentol;(2R,3S,4S)-2,6,6-trimethylheptane-1,3,4-triol;(2S,3R,4S,5R)-3,7,7-trimethyloctane-1,2,4,5-tetrol (PubChem CID 159414680) has the molecular formula C31H68O12 and a molecular weight of 632.87 g/mol. Its IUPAC name is (2R,3R,4R,5S)-7,7-dimethyloctane-1,2,3,4,5-pentol;(2R,3S,4S)-2,6,6-trimethylheptane-1,3,4-triol;(2S,3R,4S,5R)-3,7,7-trimethyloctane-1,2,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S)-7,7-dimethyloctane-1,2,3,4,5-pentol;(2R,3S,4S)-2,6,6-trimethylheptane-1,3,4-triol;(2S,3R,4S,5R)-3,7,7-trimethyloctane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 159414680 |
| Molecular Formula | C31H68O12 |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.47 |
| IUPAC Name | (2R,3R,4R,5S)-7,7-dimethyloctane-1,2,3,4,5-pentol;(2R,3S,4S)-2,6,6-trimethylheptane-1,3,4-triol;(2S,3R,4S,5R)-3,7,7-trimethyloctane-1,2,4,5-tetrol |
| SMILES | CC(C)(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.C[C@@H]([C@H](O)[C@H](O)CC(C)(C)C)[C@H](O)CO.C[C@H](CO)[C@H](O)[C@@H](O)CC(C)(C)C |
| InChI | InChI=1S/C11H24O4.C10H22O5.C10H22O3/c1-7(9(14)6-12)10(15)8(13)5-11(2,3)4;1-10(2,3)4-6(12)8(14)9(15)7(13)5-11;1-7(6-11)9(13)8(12)5-10(2,3)4/h7-10,12-15H,5-6H2,1-4H3;6-9,11-15H,4-5H2,1-3H3;7-9,11-13H,5-6H2,1-4H3/t7-,8-,9-,10+;6-,7+,8+,9+;7-,8+,9+/m101/s1 |
| InChIKey | LPAAHHIRUDHVHI-WWHURNSCSA-N |
| XLogP | -0.23 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |