C10H22O4 — CID 58202019
(2S,3R,4S,5R)-7,7-dimethyloctane-2,3,4,5-tetrol (PubChem CID 58202019) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is (2S,3R,4S,5R)-7,7-dimethyloctane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R)-7,7-dimethyloctane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 58202019 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (2S,3R,4S,5R)-7,7-dimethyloctane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CC(C)(C)C |
| InChI | InChI=1S/C10H22O4/c1-6(11)8(13)9(14)7(12)5-10(2,3)4/h6-9,11-14H,5H2,1-4H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | RLQDXGYJWOYIKH-KDXUFGMBSA-N |
| XLogP | -0.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |