C3H6F2IrO2 — CID 174140036
1,3-difluoropropane-1,3-diol;iridium (PubChem CID 174140036) has the molecular formula C3H6F2IrO2 and a molecular weight of 304.29 g/mol. Its IUPAC name is 1,3-difluoropropane-1,3-diol;iridium.
| Compound Name | 1,3-difluoropropane-1,3-diol;iridium |
|---|---|
| PubChem CID | 174140036 |
| Molecular Formula | C3H6F2IrO2 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 1,3-difluoropropane-1,3-diol;iridium |
| SMILES | OC(F)CC(O)F.[Ir] |
| InChI | InChI=1S/C3H6F2O2.Ir/c4-2(6)1-3(5)7;/h2-3,6-7H,1H2; |
| InChIKey | HJVOLVDNBXLQFA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |