C4H6F4O2 — CID 22595048
1,2,3,4-tetrafluorobutane-1,4-diol (PubChem CID 22595048) has the molecular formula C4H6F4O2 and a molecular weight of 162.08 g/mol. Its IUPAC name is 1,2,3,4-tetrafluorobutane-1,4-diol.
| Compound Name | 1,2,3,4-tetrafluorobutane-1,4-diol |
|---|---|
| PubChem CID | 22595048 |
| Molecular Formula | C4H6F4O2 |
| Molecular Weight | 162.08 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 1,2,3,4-tetrafluorobutane-1,4-diol |
| SMILES | OC(F)C(F)C(F)C(O)F |
| InChI | InChI=1S/C4H6F4O2/c5-1(3(7)9)2(6)4(8)10/h1-4,9-10H |
| InChIKey | NIBDTHKVEBXNRY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.08 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |