C8H17FO — CID 177129718
(3S,4S)-4-fluoro-2,5-dimethylhexan-3-ol (PubChem CID 177129718) has the molecular formula C8H17FO and a molecular weight of 148.22 g/mol. Its IUPAC name is (3S,4S)-4-fluoro-2,5-dimethylhexan-3-ol.
| Compound Name | (3S,4S)-4-fluoro-2,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 177129718 |
| Molecular Formula | C8H17FO |
| Molecular Weight | 148.22 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (3S,4S)-4-fluoro-2,5-dimethylhexan-3-ol |
| SMILES | CC(C)[C@H](O)[C@@H](F)C(C)C |
| InChI | InChI=1S/C8H17FO/c1-5(2)7(9)8(10)6(3)4/h5-8,10H,1-4H3/t7-,8-/m0/s1 |
| InChIKey | LKMDWZFBHUMNRT-YUMQZZPRSA-N |
| XLogP | 2.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |