About 1-hydroxyethylazanium tetrafluoroborate
1-hydroxyethylazanium tetrafluoroborate (PubChem CID 87299825) has the molecular formula C2H8BF4NO
and a molecular weight of 148.90 g/mol. Its IUPAC name is 1-hydroxyethylazanium tetrafluoroborate.
Molecular Properties
| Compound Name | 1-hydroxyethylazanium tetrafluoroborate |
| PubChem CID | 87299825 |
| Molecular Formula | C2H8BF4NO |
| Molecular Weight | 148.90 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 1-hydroxyethylazanium tetrafluoroborate |
| SMILES | CC([NH3+])O.F[B-](F)(F)F |
| InChI | InChI=1S/C2H7NO.BF4/c1-2(3)4;2-1(3,4)5/h2,4H,3H2,1H3;/q;-1/p+1 |
| InChIKey | XPPKLGUXMZRVOZ-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.90 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethylazanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethylazanium tetrafluoroborate?
The IUPAC name of 1-hydroxyethylazanium tetrafluoroborate (CID 87299825) is 1-hydroxyethylazanium tetrafluoroborate.
What is the SMILES notation for 1-hydroxyethylazanium tetrafluoroborate?
The canonical SMILES for 1-hydroxyethylazanium tetrafluoroborate is CC([NH3+])O.F[B-](F)(F)F.
What is the InChIKey of 1-hydroxyethylazanium tetrafluoroborate?
The InChIKey is XPPKLGUXMZRVOZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H7NO.BF4/c1-2(3)4;2-1(3,4)5/h2,4H,3H2,1H3;/q;-1/p+1.
What are the key properties of 1-hydroxyethylazanium tetrafluoroborate?
1-hydroxyethylazanium tetrafluoroborate has a molecular weight of 148.90 g/mol, XLogP of -0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethylazanium tetrafluoroborate is sourced from PubChem (CID 87299825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).