C6H11FO4 — CID 172832084
(2S,3R,4S,5S)-3-(18F)fluoro-2,4,5-trihydroxyhexanal (PubChem CID 172832084) has the molecular formula C6H11FO4 and a molecular weight of 165.15 g/mol. Its IUPAC name is (2S,3R,4S,5S)-3-(18F)fluoro-2,4,5-trihydroxyhexanal.
| Compound Name | (2S,3R,4S,5S)-3-(18F)fluoro-2,4,5-trihydroxyhexanal |
|---|---|
| PubChem CID | 172832084 |
| Molecular Formula | C6H11FO4 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (2S,3R,4S,5S)-3-(18F)fluoro-2,4,5-trihydroxyhexanal |
| SMILES | C[C@H](O)[C@H](O)[C@@H]([18F])[C@@H](O)C=O |
| InChI | InChI=1S/C6H11FO4/c1-3(9)6(11)5(7)4(10)2-8/h2-6,9-11H,1H3/t3-,4-,5-,6-/m0/s1/i7-1 |
| InChIKey | VQMYUHHEMXBLFA-UMKHKONISA-N |
| XLogP | -1.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|