C6H13NO4 — CID 141062865
(2S,3S,4S,5R)-3-(deuterioamino)-2,4,5-trihydroxyhexanal (PubChem CID 141062865) has the molecular formula C6H13NO4 and a molecular weight of 164.18 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3-(deuterioamino)-2,4,5-trihydroxyhexanal.
| Compound Name | (2S,3S,4S,5R)-3-(deuterioamino)-2,4,5-trihydroxyhexanal |
|---|---|
| PubChem CID | 141062865 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (2S,3S,4S,5R)-3-(deuterioamino)-2,4,5-trihydroxyhexanal |
| SMILES | [2H]N[C@@H]([C@H](O)[C@@H](C)O)[C@H](O)C=O |
| InChI | InChI=1S/C6H13NO4/c1-3(9)6(11)5(7)4(10)2-8/h2-6,9-11H,7H2,1H3/t3-,4-,5-,6-/m1/s1/i/hD |
| InChIKey | DTSSDPFTHGBSDX-UDSPDPSBSA-N |
| XLogP | -2.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|