C10H20F2 — CID 170657718
3,5-difluoro-2,4,6-trimethylheptane (PubChem CID 170657718) has the molecular formula C10H20F2 and a molecular weight of 178.27 g/mol. Its IUPAC name is 3,5-difluoro-2,4,6-trimethylheptane.
| Compound Name | 3,5-difluoro-2,4,6-trimethylheptane |
|---|---|
| PubChem CID | 170657718 |
| Molecular Formula | C10H20F2 |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3,5-difluoro-2,4,6-trimethylheptane |
| SMILES | CC(C)C(F)C(C)C(F)C(C)C |
| InChI | InChI=1S/C10H20F2/c1-6(2)9(11)8(5)10(12)7(3)4/h6-10H,1-5H3 |
| InChIKey | FVGONQBEJSALPI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |