About 1-fluoroheptane-1,7-diol
1-fluoroheptane-1,7-diol (PubChem CID 174774805) has the molecular formula C7H15FO2
and a molecular weight of 150.19 g/mol. Its IUPAC name is 1-fluoroheptane-1,7-diol.
Molecular Properties
| Compound Name | 1-fluoroheptane-1,7-diol |
| PubChem CID | 174774805 |
| Molecular Formula | C7H15FO2 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.11 |
| IUPAC Name | 1-fluoroheptane-1,7-diol |
| SMILES | OCCCCCCC(O)F |
| InChI | InChI=1S/C7H15FO2/c8-7(10)5-3-1-2-4-6-9/h7,9-10H,1-6H2 |
| InChIKey | YHTOAROTNOCSBI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroheptane-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroheptane-1,7-diol?
The IUPAC name of 1-fluoroheptane-1,7-diol (CID 174774805) is 1-fluoroheptane-1,7-diol.
What is the SMILES notation for 1-fluoroheptane-1,7-diol?
The canonical SMILES for 1-fluoroheptane-1,7-diol is OCCCCCCC(O)F.
What is the InChIKey of 1-fluoroheptane-1,7-diol?
The InChIKey is YHTOAROTNOCSBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15FO2/c8-7(10)5-3-1-2-4-6-9/h7,9-10H,1-6H2.
What are the key properties of 1-fluoroheptane-1,7-diol?
1-fluoroheptane-1,7-diol has a molecular weight of 150.19 g/mol, XLogP of 1.22, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroheptane-1,7-diol is sourced from PubChem (CID 174774805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).