C5H11F2N — CID 176965974
(2R)-3,3-difluoro-N,2-dimethylpropan-1-amine (PubChem CID 176965974) has the molecular formula C5H11F2N and a molecular weight of 123.15 g/mol. Its IUPAC name is (2R)-3,3-difluoro-N,2-dimethylpropan-1-amine.
| Compound Name | (2R)-3,3-difluoro-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 176965974 |
| Molecular Formula | C5H11F2N |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | (2R)-3,3-difluoro-N,2-dimethylpropan-1-amine |
| SMILES | CNC[C@@H](C)C(F)F |
| InChI | InChI=1S/C5H11F2N/c1-4(3-8-2)5(6)7/h4-5,8H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | KEHSBCMXBWESQZ-SCSAIBSYSA-N |
| XLogP | 1.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |