C15H33N — CID 162040885
(3S,4R)-N,2,3,4,5,7,7-heptamethyloctan-1-amine (PubChem CID 162040885) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is (3S,4R)-N,2,3,4,5,7,7-heptamethyloctan-1-amine.
| Compound Name | (3S,4R)-N,2,3,4,5,7,7-heptamethyloctan-1-amine |
|---|---|
| PubChem CID | 162040885 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | (3S,4R)-N,2,3,4,5,7,7-heptamethyloctan-1-amine |
| SMILES | CNCC(C)[C@@H](C)[C@H](C)C(C)CC(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-11(9-15(5,6)7)13(3)14(4)12(2)10-16-8/h11-14,16H,9-10H2,1-8H3/t11?,12?,13-,14-/m1/s1 |
| InChIKey | DDFFAWQWBWCFIO-NWINJMCUSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |