C28H58NO2Y- — CID 162040884
(2S,4S,5S)-6-(2,2-dimethylpropyl)-3,4,5-trimethyloxan-2-ol;(3S,4R)-5-methanidyl-N,2,3,4,7,7-hexamethyloctan-1-amine;yttrium (PubChem CID 162040884) has the molecular formula C28H58NO2Y- and a molecular weight of 529.68 g/mol. Its IUPAC name is (2S,4S,5S)-6-(2,2-dimethylpropyl)-3,4,5-trimethyloxan-2-ol;(3S,4R)-5-methanidyl-N,2,3,4,7,7-hexamethyloctan-1-amine;yttrium.
| Compound Name | (2S,4S,5S)-6-(2,2-dimethylpropyl)-3,4,5-trimethyloxan-2-ol;(3S,4R)-5-methanidyl-N,2,3,4,7,7-hexamethyloctan-1-amine;yttrium |
|---|---|
| PubChem CID | 162040884 |
| Molecular Formula | C28H58NO2Y- |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.35 |
| IUPAC Name | (2S,4S,5S)-6-(2,2-dimethylpropyl)-3,4,5-trimethyloxan-2-ol;(3S,4R)-5-methanidyl-N,2,3,4,7,7-hexamethyloctan-1-amine;yttrium |
| SMILES | CC1[C@@H](C)[C@H](C)C(CC(C)(C)C)O[C@@H]1O.[CH2-]C(CC(C)(C)C)[C@@H](C)[C@H](C)C(C)CNC.[Y] |
| InChI | InChI=1S/C15H32N.C13H26O2.Y/c1-11(9-15(5,6)7)13(3)14(4)12(2)10-16-8;1-8-9(2)11(7-13(4,5)6)15-12(14)10(8)3;/h11-14,16H,1,9-10H2,2-8H3;8-12,14H,7H2,1-6H3;/q-1;;/t11?,12?,13-,14-;8-,9-,10?,11?,12-;/m10./s1 |
| InChIKey | RPTZEJVBDOSVMM-ZOAHLPTMSA-N |
| XLogP | 7.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|