C12H24O2 — CID 159707084
6-butan-2-yl-3,4,5-trimethyloxan-2-ol (PubChem CID 159707084) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 6-butan-2-yl-3,4,5-trimethyloxan-2-ol.
| Compound Name | 6-butan-2-yl-3,4,5-trimethyloxan-2-ol |
|---|---|
| PubChem CID | 159707084 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 6-butan-2-yl-3,4,5-trimethyloxan-2-ol |
| SMILES | CCC(C)C1OC(O)C(C)C(C)C1C |
| InChI | InChI=1S/C12H24O2/c1-6-7(2)11-9(4)8(3)10(5)12(13)14-11/h7-13H,6H2,1-5H3 |
| InChIKey | MBIVIIPIHYQROJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |