C11H22O3 — CID 101050085
(2S,4S,5R,6S)-5-methyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol (PubChem CID 101050085) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (2S,4S,5R,6S)-5-methyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol.
| Compound Name | (2S,4S,5R,6S)-5-methyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol |
|---|---|
| PubChem CID | 101050085 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (2S,4S,5R,6S)-5-methyl-2,6-di(propan-2-yl)-1,3-dioxan-4-ol |
| SMILES | CC(C)[C@@H]1O[C@H](O)[C@H](C)[C@H](C(C)C)O1 |
| InChI | InChI=1S/C11H22O3/c1-6(2)9-8(5)10(12)14-11(13-9)7(3)4/h6-12H,1-5H3/t8-,9+,10+,11+/m1/s1 |
| InChIKey | WAKTVRVLZVZOPV-RCWTZXSCSA-N |
| XLogP | 1.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |