C12H24O2PS+ — CID 12865666
2,4,6-tri(propan-2-yl)-5-sulfanylidene-1,3,5-dioxaphosphinan-5-ium (PubChem CID 12865666) has the molecular formula C12H24O2PS+ and a molecular weight of 263.36 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yl)-5-sulfanylidene-1,3,5-dioxaphosphinan-5-ium.
| Compound Name | 2,4,6-tri(propan-2-yl)-5-sulfanylidene-1,3,5-dioxaphosphinan-5-ium |
|---|---|
| PubChem CID | 12865666 |
| Molecular Formula | C12H24O2PS+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2,4,6-tri(propan-2-yl)-5-sulfanylidene-1,3,5-dioxaphosphinan-5-ium |
| SMILES | CC(C)C1OC(C(C)C)[P+](=S)C(C(C)C)O1 |
| InChI | InChI=1S/C12H24O2PS/c1-7(2)10-13-11(8(3)4)15(16)12(14-10)9(5)6/h7-12H,1-6H3/q+1 |
| InChIKey | UHLVDACSHHGPJK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|