C11H22N2O6Pt — CID 6918271
[(4R,5R)-5-(aminomethyl)-2-propan-2-yl-1,3-dioxolan-4-yl]methanamine;platinum;propanedioic acid (PubChem CID 6918271) has the molecular formula C11H22N2O6Pt and a molecular weight of 473.38 g/mol. Its IUPAC name is [(4R,5R)-5-(aminomethyl)-2-propan-2-yl-1,3-dioxolan-4-yl]methanamine;platinum;propanedioic acid.
| Compound Name | [(4R,5R)-5-(aminomethyl)-2-propan-2-yl-1,3-dioxolan-4-yl]methanamine;platinum;propanedioic acid |
|---|---|
| PubChem CID | 6918271 |
| Molecular Formula | C11H22N2O6Pt |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | [(4R,5R)-5-(aminomethyl)-2-propan-2-yl-1,3-dioxolan-4-yl]methanamine;platinum;propanedioic acid |
| SMILES | CC(C)C1O[C@H](CN)[C@@H](CN)O1.O=C(O)CC(=O)O.[Pt] |
| InChI | InChI=1S/C8H18N2O2.C3H4O4.Pt/c1-5(2)8-11-6(3-9)7(4-10)12-8;4-2(5)1-3(6)7;/h5-8H,3-4,9-10H2,1-2H3;1H2,(H,4,5)(H,6,7);/t6-,7-;;/m1../s1 |
| InChIKey | AINAHBKLRQMAFW-GPJOBVNKSA-N |
| XLogP | -0.79 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|