About diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate
diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 22852087) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate.
Analyze diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
The IUPAC name of diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate (CID 22852087) is diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate.
What is the SMILES notation for diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
The canonical SMILES for diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate is CCOC(=O)[C@H]1OC(C(C)C)O[C@@H]1C(=O)OCC.
What is the InChIKey of diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
The InChIKey is QKAAWFQMWNTBAB-IUCAKERBSA-N. The full InChI is InChI=1S/C12H20O6/c1-5-15-10(13)8-9(11(14)16-6-2)18-12(17-8)7(3)4/h7-9,12H,5-6H2,1-4H3/t8-,9-/m0/s1.
What are the key properties of diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate?
diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate has a molecular weight of 260.29 g/mol, XLogP of 0.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (4S,5S)-2-propan-2-yl-1,3-dioxolane-4,5-dicarboxylate is sourced from PubChem (CID 22852087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).