C12H19NO6 — CID 11043936
(2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 11043936) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11043936 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2S)-2-[[(2S,3S)-3-ethoxycarbonyloxirane-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CCOC(=O)[C@H]1O[C@@H]1C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H19NO6/c1-4-18-12(17)9-8(19-9)10(14)13-7(11(15)16)5-6(2)3/h6-9H,4-5H2,1-3H3,(H,13,14)(H,15,16)/t7-,8-,9-/m0/s1 |
| InChIKey | AEJRFHMESVIYRR-CIUDSAMLSA-N |
| XLogP | -0.07 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|