C25H35N3O5 — CID 57207049
ethyl 3-[[4-methyl-1-oxo-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 57207049) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is ethyl 3-[[4-methyl-1-oxo-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl 3-[[4-methyl-1-oxo-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 57207049 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | ethyl 3-[[4-methyl-1-oxo-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1OC1C(=O)NC(CC(C)C)C(=O)N1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H35N3O5/c1-4-32-25(31)22-21(33-22)23(29)26-20(17-18(2)3)24(30)28-15-13-27(14-16-28)12-8-11-19-9-6-5-7-10-19/h5-11,18,20-22H,4,12-17H2,1-3H3,(H,26,29) |
| InChIKey | OXERTMTWUPRZSF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|