C15H25N3O5 — CID 88678897
(2R,3R)-3-[[(2S)-4-methyl-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid (PubChem CID 88678897) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2R,3R)-3-[[(2S)-4-methyl-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid.
| Compound Name | (2R,3R)-3-[[(2S)-4-methyl-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 88678897 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2R,3R)-3-[[(2S)-4-methyl-1-(4-methylpiperazin-1-yl)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1O[C@H]1C(=O)O)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H25N3O5/c1-9(2)8-10(14(20)18-6-4-17(3)5-7-18)16-13(19)11-12(23-11)15(21)22/h9-12H,4-8H2,1-3H3,(H,16,19)(H,21,22)/t10-,11+,12+/m0/s1 |
| InChIKey | FDDDRKCQRLKHRX-QJPTWQEYSA-N |
| XLogP | -0.86 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|