C19H25N4NaO5 — CID 23711642
sodium 3-[[4-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 23711642) has the molecular formula C19H25N4NaO5 and a molecular weight of 412.42 g/mol. Its IUPAC name is sodium 3-[[4-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | sodium 3-[[4-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 23711642 |
| Molecular Formula | C19H25N4NaO5 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | sodium 3-[[4-methyl-1-oxo-1-(4-pyridin-2-ylpiperazin-1-yl)pentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | CC(C)CC(NC(=O)C1OC1C(=O)[O-])C(=O)N1CCN(c2ccccn2)CC1.[Na+] |
| InChI | InChI=1S/C19H26N4O5.Na/c1-12(2)11-13(21-17(24)15-16(28-15)19(26)27)18(25)23-9-7-22(8-10-23)14-5-3-4-6-20-14;/h3-6,12-13,15-16H,7-11H2,1-2H3,(H,21,24)(H,26,27);/q;+1/p-1 |
| InChIKey | HJRJWEDSQJSTGS-UHFFFAOYSA-M |
| XLogP | -4.22 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|