C18H31N3O5 — CID 57284051
3-[[4-methyl-1-[4-(2-methylpropyl)piperazin-1-yl]-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid (PubChem CID 57284051) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-[[4-methyl-1-[4-(2-methylpropyl)piperazin-1-yl]-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid.
| Compound Name | 3-[[4-methyl-1-[4-(2-methylpropyl)piperazin-1-yl]-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 57284051 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 3-[[4-methyl-1-[4-(2-methylpropyl)piperazin-1-yl]-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
| SMILES | CC(C)CC(NC(=O)C1OC1C(=O)O)C(=O)N1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C18H31N3O5/c1-11(2)9-13(19-16(22)14-15(26-14)18(24)25)17(23)21-7-5-20(6-8-21)10-12(3)4/h11-15H,5-10H2,1-4H3,(H,19,22)(H,24,25) |
| InChIKey | VXBRIEZWJUKWKG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|