C23H30N2O3 — CID 91168088
(1R,6R)-3,4-dimethyl-6-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 91168088) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is (1R,6R)-3,4-dimethyl-6-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6R)-3,4-dimethyl-6-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 91168088 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (1R,6R)-3,4-dimethyl-6-[4-(3-phenylprop-2-enyl)piperazine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@@H](C(=O)N2CCN(CC=Cc3ccccc3)CC2)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C23H30N2O3/c1-17-15-20(21(23(27)28)16-18(17)2)22(26)25-13-11-24(12-14-25)10-6-9-19-7-4-3-5-8-19/h3-9,20-21H,10-16H2,1-2H3,(H,27,28)/t20-,21-/m1/s1 |
| InChIKey | HDXDGJAFSMKENE-NHCUHLMSSA-N |
| XLogP | 3.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|