C21H28N2O3 — CID 1149453
(1S,6S)-6-(4-benzylpiperazine-1-carbonyl)-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 1149453) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (1S,6S)-6-(4-benzylpiperazine-1-carbonyl)-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-(4-benzylpiperazine-1-carbonyl)-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 1149453 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (1S,6S)-6-(4-benzylpiperazine-1-carbonyl)-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C)C[C@H](C(=O)N2CCN(Cc3ccccc3)CC2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C21H28N2O3/c1-15-12-18(19(21(25)26)13-16(15)2)20(24)23-10-8-22(9-11-23)14-17-6-4-3-5-7-17/h3-7,18-19H,8-14H2,1-2H3,(H,25,26)/t18-,19-/m0/s1 |
| InChIKey | HQKSZMPYLDTIRF-OALUTQOASA-N |
| XLogP | 2.78 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|