C16H27N5O5 — CID 169433821
ethyl (2S,3S)-3-[[(2S)-1-[(4-azido-1,1,2,2,3,3,4,4-octadeuteriobutyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 169433821) has the molecular formula C16H27N5O5 and a molecular weight of 377.47 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[(2S)-1-[(4-azido-1,1,2,2,3,3,4,4-octadeuteriobutyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[(2S)-1-[(4-azido-1,1,2,2,3,3,4,4-octadeuteriobutyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 169433821 |
| Molecular Formula | C16H27N5O5 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | ethyl (2S,3S)-3-[[(2S)-1-[(4-azido-1,1,2,2,3,3,4,4-octadeuteriobutyl)amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | [2H]C([2H])(N=[N+]=[N-])C([2H])([2H])C([2H])([2H])C([2H])([2H])NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1O[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C16H27N5O5/c1-4-25-16(24)13-12(26-13)15(23)20-11(9-10(2)3)14(22)18-7-5-6-8-19-21-17/h10-13H,4-9H2,1-3H3,(H,18,22)(H,20,23)/t11-,12-,13-/m0/s1/i5D2,6D2,7D2,8D2 |
| InChIKey | HTLLROXSRRARPI-JYGASIIVSA-N |
| XLogP | 1.05 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|