C17H29IN2O5 — CID 15168143
2-iodoethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 15168143) has the molecular formula C17H29IN2O5 and a molecular weight of 468.33 g/mol. Its IUPAC name is 2-iodoethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | 2-iodoethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 15168143 |
| Molecular Formula | C17H29IN2O5 |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-iodoethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | CC(C)CCNC(=O)[C@H](CC(C)C)NC(=O)[C@H]1O[C@@H]1C(=O)OCCI |
| InChI | InChI=1S/C17H29IN2O5/c1-10(2)5-7-19-15(21)12(9-11(3)4)20-16(22)13-14(25-13)17(23)24-8-6-18/h10-14H,5-9H2,1-4H3,(H,19,21)(H,20,22)/t12-,13-,14-/m0/s1 |
| InChIKey | YYZXJPDAPACBTG-IHRRRGAJSA-N |
| XLogP | 1.43 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|