C20H28N2O5 — CID 10619537
ethyl (2R,3R)-3-[[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]oxirane-2-carboxylate (PubChem CID 10619537) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-3-[[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 10619537 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | ethyl (2R,3R)-3-[[(2R)-1-(3-methylbutylamino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@H]1C(=O)N[C@H](Cc1ccccc1)C(=O)NCCC(C)C |
| InChI | InChI=1S/C20H28N2O5/c1-4-26-20(25)17-16(27-17)19(24)22-15(12-14-8-6-5-7-9-14)18(23)21-11-10-13(2)3/h5-9,13,15-17H,4,10-12H2,1-3H3,(H,21,23)(H,22,24)/t15-,16-,17-/m1/s1 |
| InChIKey | ASBGHYKMMMIAOS-BRWVUGGUSA-N |
| XLogP | 1.21 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|