C23H25N3O7 — CID 10343980
ethyl 3-[[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]carbamoyl]oxirane-2-carboxylate (PubChem CID 10343980) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is ethyl 3-[[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl 3-[[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 10343980 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | ethyl 3-[[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1OC1C(=O)NNC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O7/c1-2-31-22(29)19-18(33-19)21(28)26-25-20(27)17(13-15-9-5-3-6-10-15)24-23(30)32-14-16-11-7-4-8-12-16/h3-12,17-19H,2,13-14H2,1H3,(H,24,30)(H,25,27)(H,26,28)/t17-,18?,19?/m0/s1 |
| InChIKey | LUYJXCAPTYAAHW-VIQWUECVSA-N |
| XLogP | 1.00 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|