C32H41N5O9 — CID 11621561
ethyl 3-[(3-amino-3-oxopropyl)-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]carbamoyl]oxirane-2-carboxylate (PubChem CID 11621561) has the molecular formula C32H41N5O9 and a molecular weight of 639.71 g/mol. Its IUPAC name is ethyl 3-[(3-amino-3-oxopropyl)-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl 3-[(3-amino-3-oxopropyl)-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 11621561 |
| Molecular Formula | C32H41N5O9 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.29 |
| IUPAC Name | ethyl 3-[(3-amino-3-oxopropyl)-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-3-phenylpropanoyl]amino]carbamoyl]oxirane-2-carboxylate |
| SMILES | CCOC(=O)C1OC1C(=O)N(CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H41N5O9/c1-4-44-31(42)27-26(46-27)30(41)37(16-15-25(33)38)36-29(40)24(18-21-11-7-5-8-12-21)34-28(39)23(17-20(2)3)35-32(43)45-19-22-13-9-6-10-14-22/h5-14,20,23-24,26-27H,4,15-19H2,1-3H3,(H2,33,38)(H,34,39)(H,35,43)(H,36,40)/t23-,24-,26?,27?/m0/s1 |
| InChIKey | HBWFNALDLLDXEL-URYVUTJFSA-N |
| XLogP | 1.12 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|