C27H43N5O8 — CID 156906454
ethyl 3-[(3-amino-3-oxopropyl)-[[(2R)-2-[[(2S)-2-(hex-5-ynoylamino)-3,3-dimethylbutanoyl]amino]-4-methylpentanoyl]amino]carbamoyl]oxirane-2-carboxylate (PubChem CID 156906454) has the molecular formula C27H43N5O8 and a molecular weight of 565.67 g/mol. Its IUPAC name is ethyl 3-[(3-amino-3-oxopropyl)-[[(2R)-2-[[(2S)-2-(hex-5-ynoylamino)-3,3-dimethylbutanoyl]amino]-4-methylpentanoyl]amino]carbamoyl]oxirane-2-carboxylate.
| Compound Name | ethyl 3-[(3-amino-3-oxopropyl)-[[(2R)-2-[[(2S)-2-(hex-5-ynoylamino)-3,3-dimethylbutanoyl]amino]-4-methylpentanoyl]amino]carbamoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 156906454 |
| Molecular Formula | C27H43N5O8 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | ethyl 3-[(3-amino-3-oxopropyl)-[[(2R)-2-[[(2S)-2-(hex-5-ynoylamino)-3,3-dimethylbutanoyl]amino]-4-methylpentanoyl]amino]carbamoyl]oxirane-2-carboxylate |
| SMILES | C#CCCCC(=O)N[C@H](C(=O)N[C@H](CC(C)C)C(=O)NN(CCC(N)=O)C(=O)C1OC1C(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C27H43N5O8/c1-8-10-11-12-19(34)30-22(27(5,6)7)24(36)29-17(15-16(3)4)23(35)31-32(14-13-18(28)33)25(37)20-21(40-20)26(38)39-9-2/h1,16-17,20-22H,9-15H2,2-7H3,(H2,28,33)(H,29,36)(H,30,34)(H,31,35)/t17-,20?,21?,22-/m1/s1 |
| InChIKey | BLJMVSBNQKASLS-MTWWTJSRSA-N |
| XLogP | -0.08 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|