C12H20ClFN4O5 — CID 172829366
[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 172829366) has the molecular formula C12H20ClFN4O5 and a molecular weight of 354.77 g/mol. Its IUPAC name is [(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 172829366 |
| Molecular Formula | C12H20ClFN4O5 |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)C[C@H](NC(=O)O)C(=O)NN(CCC(N)=O)C(=O)[C@H](F)Cl |
| InChI | InChI=1S/C12H20ClFN4O5/c1-6(2)5-7(16-12(22)23)10(20)17-18(4-3-8(15)19)11(21)9(13)14/h6-7,9,16H,3-5H2,1-2H3,(H2,15,19)(H,17,20)(H,22,23)/t7-,9-/m0/s1 |
| InChIKey | VHQYXIJIIZIXDN-CBAPKCEASA-N |
| XLogP | -0.06 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|