C16H23ClFN5O5 — CID 162739150
N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2S)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 162739150) has the molecular formula C16H23ClFN5O5 and a molecular weight of 419.84 g/mol. Its IUPAC name is N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2S)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2S)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 162739150 |
| Molecular Formula | C16H23ClFN5O5 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2S)-2-chloro-2-fluoroacetyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](CC(C)C)C(=O)NN(CCC(N)=O)C(=O)[C@@H](F)Cl)no1 |
| InChI | InChI=1S/C16H23ClFN5O5/c1-8(2)6-10(20-14(25)11-7-9(3)28-22-11)15(26)21-23(5-4-12(19)24)16(27)13(17)18/h7-8,10,13H,4-6H2,1-3H3,(H2,19,24)(H,20,25)(H,21,26)/t10-,13+/m0/s1 |
| InChIKey | QTXYZQPUYLPWTK-GXFFZTMASA-N |
| XLogP | 0.40 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|