C21H24ClFN6O4 — CID 162739055
N-[1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]-1H-benzimidazole-2-carboxamide (PubChem CID 162739055) has the molecular formula C21H24ClFN6O4 and a molecular weight of 478.91 g/mol. Its IUPAC name is N-[1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 162739055 |
| Molecular Formula | C21H24ClFN6O4 |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[1-[2-(3-amino-3-oxopropyl)-2-(2-chloro-2-fluoroacetyl)hydrazinyl]-3-(1-bicyclo[1.1.1]pentanyl)-1-oxopropan-2-yl]-1H-benzimidazole-2-carboxamide |
| SMILES | NC(=O)CCN(NC(=O)C(CC12CC(C1)C2)NC(=O)c1nc2ccccc2[nH]1)C(=O)C(F)Cl |
| InChI | InChI=1S/C21H24ClFN6O4/c22-16(23)20(33)29(6-5-15(24)30)28-18(31)14(10-21-7-11(8-21)9-21)27-19(32)17-25-12-3-1-2-4-13(12)26-17/h1-4,11,14,16H,5-10H2,(H2,24,30)(H,25,26)(H,27,32)(H,28,31) |
| InChIKey | OKYHUCKJGQXMCW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|