C20H25ClFN5O4 — CID 163432680
3-[[(2S)-2-chloro-2-fluoroacetyl]-[[(2R)-4-methyl-2-[2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-2-yl)ethyl]pentanoyl]amino]amino]propanamide (PubChem CID 163432680) has the molecular formula C20H25ClFN5O4 and a molecular weight of 453.90 g/mol. Its IUPAC name is 3-[[(2S)-2-chloro-2-fluoroacetyl]-[[(2R)-4-methyl-2-[2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-2-yl)ethyl]pentanoyl]amino]amino]propanamide.
| Compound Name | 3-[[(2S)-2-chloro-2-fluoroacetyl]-[[(2R)-4-methyl-2-[2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-2-yl)ethyl]pentanoyl]amino]amino]propanamide |
|---|---|
| PubChem CID | 163432680 |
| Molecular Formula | C20H25ClFN5O4 |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 3-[[(2S)-2-chloro-2-fluoroacetyl]-[[(2R)-4-methyl-2-[2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-2-yl)ethyl]pentanoyl]amino]amino]propanamide |
| SMILES | CC(C)C[C@H](CC(=O)c1cc2ncccc2[nH]1)C(=O)NN(CCC(N)=O)C(=O)[C@@H](F)Cl |
| InChI | InChI=1S/C20H25ClFN5O4/c1-11(2)8-12(9-16(28)15-10-14-13(25-15)4-3-6-24-14)19(30)26-27(7-5-17(23)29)20(31)18(21)22/h3-4,6,10-12,18,25H,5,7-9H2,1-2H3,(H2,23,29)(H,26,30)/t12-,18-/m1/s1 |
| InChIKey | XGDYTCWYUSHVEU-KZULUSFZSA-N |
| XLogP | 2.07 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|