C22H31ClFN3O5S — CID 163582564
3-[[[(2S)-2-(benzylsulfonylmethyl)-3-cyclohexylpropanoyl]amino]-(2-chloro-2-fluoroacetyl)amino]propanamide (PubChem CID 163582564) has the molecular formula C22H31ClFN3O5S and a molecular weight of 504.02 g/mol. Its IUPAC name is 3-[[[(2S)-2-(benzylsulfonylmethyl)-3-cyclohexylpropanoyl]amino]-(2-chloro-2-fluoroacetyl)amino]propanamide.
| Compound Name | 3-[[[(2S)-2-(benzylsulfonylmethyl)-3-cyclohexylpropanoyl]amino]-(2-chloro-2-fluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 163582564 |
| Molecular Formula | C22H31ClFN3O5S |
| Molecular Weight | 504.02 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 3-[[[(2S)-2-(benzylsulfonylmethyl)-3-cyclohexylpropanoyl]amino]-(2-chloro-2-fluoroacetyl)amino]propanamide |
| SMILES | NC(=O)CCN(NC(=O)[C@H](CC1CCCCC1)CS(=O)(=O)Cc1ccccc1)C(=O)C(F)Cl |
| InChI | InChI=1S/C22H31ClFN3O5S/c23-20(24)22(30)27(12-11-19(25)28)26-21(29)18(13-16-7-3-1-4-8-16)15-33(31,32)14-17-9-5-2-6-10-17/h2,5-6,9-10,16,18,20H,1,3-4,7-8,11-15H2,(H2,25,28)(H,26,29)/t18-,20?/m1/s1 |
| InChIKey | GIUCXXKOXLVKEC-QSVWIEALSA-N |
| XLogP | 2.46 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|