C14H25ClN4O3 — CID 162739204
3-[[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-(2-chloroacetyl)amino]propanamide (PubChem CID 162739204) has the molecular formula C14H25ClN4O3 and a molecular weight of 332.83 g/mol. Its IUPAC name is 3-[[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-(2-chloroacetyl)amino]propanamide.
| Compound Name | 3-[[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-(2-chloroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 162739204 |
| Molecular Formula | C14H25ClN4O3 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-[[[(2S)-2-amino-3-cyclohexylpropanoyl]amino]-(2-chloroacetyl)amino]propanamide |
| SMILES | NC(=O)CCN(NC(=O)[C@@H](N)CC1CCCCC1)C(=O)CCl |
| InChI | InChI=1S/C14H25ClN4O3/c15-9-13(21)19(7-6-12(17)20)18-14(22)11(16)8-10-4-2-1-3-5-10/h10-11H,1-9,16H2,(H2,17,20)(H,18,22)/t11-/m0/s1 |
| InChIKey | JEDAYEGIPDFJTH-NSHDSACASA-N |
| XLogP | 0.26 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|