C20H29ClN4O5 — CID 162685248
benzyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloropropanoyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 162685248) has the molecular formula C20H29ClN4O5 and a molecular weight of 440.93 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloropropanoyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloropropanoyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162685248 |
| Molecular Formula | C20H29ClN4O5 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | benzyl N-[(2S)-1-[2-(3-amino-3-oxopropyl)-2-[(2R)-2-chloropropanoyl]hydrazinyl]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NN(CCC(N)=O)C(=O)[C@@H](C)Cl |
| InChI | InChI=1S/C20H29ClN4O5/c1-13(2)11-16(23-20(29)30-12-15-7-5-4-6-8-15)18(27)24-25(10-9-17(22)26)19(28)14(3)21/h4-8,13-14,16H,9-12H2,1-3H3,(H2,22,26)(H,23,29)(H,24,27)/t14-,16+/m1/s1 |
| InChIKey | FBGXOFNTFIWFDQ-ZBFHGGJFSA-N |
| XLogP | 1.69 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|