C24H30FN3O4 — CID 163541347
(2R)-N'-(2-fluoroacetyl)-2-[2-(1H-indol-2-yl)-2-oxoethyl]-4-methyl-N'-[[(1R)-2-oxocyclopentyl]methyl]pentanehydrazide (PubChem CID 163541347) has the molecular formula C24H30FN3O4 and a molecular weight of 443.52 g/mol. Its IUPAC name is (2R)-N'-(2-fluoroacetyl)-2-[2-(1H-indol-2-yl)-2-oxoethyl]-4-methyl-N'-[[(1R)-2-oxocyclopentyl]methyl]pentanehydrazide.
| Compound Name | (2R)-N'-(2-fluoroacetyl)-2-[2-(1H-indol-2-yl)-2-oxoethyl]-4-methyl-N'-[[(1R)-2-oxocyclopentyl]methyl]pentanehydrazide |
|---|---|
| PubChem CID | 163541347 |
| Molecular Formula | C24H30FN3O4 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | (2R)-N'-(2-fluoroacetyl)-2-[2-(1H-indol-2-yl)-2-oxoethyl]-4-methyl-N'-[[(1R)-2-oxocyclopentyl]methyl]pentanehydrazide |
| SMILES | CC(C)CC(CC(=O)c1cc2ccccc2[nH]1)C(=O)NN(C[C@H]1CCCC1=O)C(=O)CF |
| InChI | InChI=1S/C24H30FN3O4/c1-15(2)10-18(12-22(30)20-11-16-6-3-4-8-19(16)26-20)24(32)27-28(23(31)13-25)14-17-7-5-9-21(17)29/h3-4,6,8,11,15,17-18,26H,5,7,9-10,12-14H2,1-2H3,(H,27,32)/t17-,18?/m1/s1 |
| InChIKey | PVLIMYOUOYEIOH-QNSVNVJESA-N |
| XLogP | 3.60 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|