C33H37N3O5 — CID 165065279
(2R)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-methyl-2-(2-oxo-2-quinolin-2-ylethyl)pentanamide (PubChem CID 165065279) has the molecular formula C33H37N3O5 and a molecular weight of 555.68 g/mol. Its IUPAC name is (2R)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-methyl-2-(2-oxo-2-quinolin-2-ylethyl)pentanamide.
| Compound Name | (2R)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-methyl-2-(2-oxo-2-quinolin-2-ylethyl)pentanamide |
|---|---|
| PubChem CID | 165065279 |
| Molecular Formula | C33H37N3O5 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (2R)-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(1S)-2-oxocyclopentyl]butan-2-yl]-4-methyl-2-(2-oxo-2-quinolin-2-ylethyl)pentanamide |
| SMILES | CC(C)C[C@H](CC(=O)c1ccc2ccccc2n1)C(=O)N[C@@H](C[C@@H]1CCCC1=O)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H37N3O5/c1-21(2)17-25(19-30(38)27-16-15-23-11-6-7-13-26(23)35-27)32(40)36-28(18-24-12-8-14-29(24)37)31(39)33(41)34-20-22-9-4-3-5-10-22/h3-7,9-11,13,15-16,21,24-25,28H,8,12,14,17-20H2,1-2H3,(H,34,41)(H,36,40)/t24-,25+,28-/m0/s1 |
| InChIKey | RVXLEGSXNVPBAO-OARDWFSCSA-N |
| XLogP | 4.60 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|