C36H36N4O5 — CID 164956024
(2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-oxo-4-quinolin-2-ylbutanamide (PubChem CID 164956024) has the molecular formula C36H36N4O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-oxo-4-quinolin-2-ylbutanamide.
| Compound Name | (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-oxo-4-quinolin-2-ylbutanamide |
|---|---|
| PubChem CID | 164956024 |
| Molecular Formula | C36H36N4O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | (2R)-2-benzyl-N-[(2S)-4-(benzylamino)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]butan-2-yl]-4-oxo-4-quinolin-2-ylbutanamide |
| SMILES | O=C(NCc1ccccc1)C(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@@H](CC(=O)c1ccc2ccccc2n1)Cc1ccccc1 |
| InChI | InChI=1S/C36H36N4O5/c41-32(30-18-17-26-14-7-8-16-29(26)39-30)22-28(20-24-10-3-1-4-11-24)35(44)40-31(21-27-15-9-19-37-34(27)43)33(42)36(45)38-23-25-12-5-2-6-13-25/h1-8,10-14,16-18,27-28,31H,9,15,19-23H2,(H,37,43)(H,38,45)(H,40,44)/t27-,28+,31-/m0/s1 |
| InChIKey | BEIYXNNCCSUARF-QXIHQKPUSA-N |
| XLogP | 3.95 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|